C25H39N5O4 — CID 90334408
[[4-[bis(butoxymethyl)amino]-6-phenyl-1,3,5-triazin-2-yl]-(cyclobutyloxymethyl)amino]methanol (PubChem CID 90334408) has the molecular formula C25H39N5O4 and a molecular weight of 473.62 g/mol. Its IUPAC name is [[4-[bis(butoxymethyl)amino]-6-phenyl-1,3,5-triazin-2-yl]-(cyclobutyloxymethyl)amino]methanol.
| Compound Name | [[4-[bis(butoxymethyl)amino]-6-phenyl-1,3,5-triazin-2-yl]-(cyclobutyloxymethyl)amino]methanol |
|---|---|
| PubChem CID | 90334408 |
| Molecular Formula | C25H39N5O4 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | [[4-[bis(butoxymethyl)amino]-6-phenyl-1,3,5-triazin-2-yl]-(cyclobutyloxymethyl)amino]methanol |
| SMILES | CCCCOCN(COCCCC)c1nc(-c2ccccc2)nc(N(CO)COC2CCC2)n1 |
| InChI | InChI=1S/C25H39N5O4/c1-3-5-15-32-18-30(19-33-16-6-4-2)25-27-23(21-11-8-7-9-12-21)26-24(28-25)29(17-31)20-34-22-13-10-14-22/h7-9,11-12,22,31H,3-6,10,13-20H2,1-2H3 |
| InChIKey | BPDZRNZQVGYEJS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|