About 2-chloro-1,4-bis(2,2-dimethylbutyl)benzene
2-chloro-1,4-bis(2,2-dimethylbutyl)benzene (PubChem CID 90334863) has the molecular formula C18H29Cl
and a molecular weight of 280.88 g/mol. Its IUPAC name is 2-chloro-1,4-bis(2,2-dimethylbutyl)benzene.
Molecular Properties
| Compound Name | 2-chloro-1,4-bis(2,2-dimethylbutyl)benzene |
| PubChem CID | 90334863 |
| Molecular Formula | C18H29Cl |
| Molecular Weight | 280.88 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2-chloro-1,4-bis(2,2-dimethylbutyl)benzene |
| SMILES | CCC(C)(C)Cc1ccc(CC(C)(C)CC)c(Cl)c1 |
| InChI | InChI=1S/C18H29Cl/c1-7-17(3,4)12-14-9-10-15(16(19)11-14)13-18(5,6)8-2/h9-11H,7-8,12-13H2,1-6H3 |
| InChIKey | YOOOJAHJHORWJM-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.88 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-chloro-1,4-bis(2,2-dimethylbutyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,4-bis(2,2-dimethylbutyl)benzene?
The IUPAC name of 2-chloro-1,4-bis(2,2-dimethylbutyl)benzene (CID 90334863) is 2-chloro-1,4-bis(2,2-dimethylbutyl)benzene.
What is the SMILES notation for 2-chloro-1,4-bis(2,2-dimethylbutyl)benzene?
The canonical SMILES for 2-chloro-1,4-bis(2,2-dimethylbutyl)benzene is CCC(C)(C)Cc1ccc(CC(C)(C)CC)c(Cl)c1.
What is the InChIKey of 2-chloro-1,4-bis(2,2-dimethylbutyl)benzene?
The InChIKey is YOOOJAHJHORWJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29Cl/c1-7-17(3,4)12-14-9-10-15(16(19)11-14)13-18(5,6)8-2/h9-11H,7-8,12-13H2,1-6H3.
What are the key properties of 2-chloro-1,4-bis(2,2-dimethylbutyl)benzene?
2-chloro-1,4-bis(2,2-dimethylbutyl)benzene has a molecular weight of 280.88 g/mol, XLogP of 6.30, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,4-bis(2,2-dimethylbutyl)benzene is sourced from PubChem (CID 90334863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).