C21H20N4OS2 — CID 9033531
(10E)-10-[[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylidene]-4,5-dimethyl-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one (PubChem CID 9033531) has the molecular formula C21H20N4OS2 and a molecular weight of 408.55 g/mol. Its IUPAC name is (10E)-10-[[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylidene]-4,5-dimethyl-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one.
| Compound Name | (10E)-10-[[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylidene]-4,5-dimethyl-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 9033531 |
| Molecular Formula | C21H20N4OS2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | (10E)-10-[[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]methylidene]-4,5-dimethyl-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
| SMILES | Cc1sc2nc3n(c(=O)c2c1C)CC/C3=C\c1cc(C)n(-c2nccs2)c1C |
| InChI | InChI=1S/C21H20N4OS2/c1-11-9-16(13(3)25(11)21-22-6-8-27-21)10-15-5-7-24-18(15)23-19-17(20(24)26)12(2)14(4)28-19/h6,8-10H,5,7H2,1-4H3/b15-10+ |
| InChIKey | MVNIDRFNJCCFOQ-XNTDXEJSSA-N |
| XLogP | 4.88 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|