About (2E)-1-piperidin-1-ylhepta-2,6-dien-1-one
(2E)-1-piperidin-1-ylhepta-2,6-dien-1-one (PubChem CID 90335627) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is (2E)-1-piperidin-1-ylhepta-2,6-dien-1-one.
Molecular Properties
| Compound Name | (2E)-1-piperidin-1-ylhepta-2,6-dien-1-one |
| PubChem CID | 90335627 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (2E)-1-piperidin-1-ylhepta-2,6-dien-1-one |
| SMILES | C=CCC/C=C/C(=O)N1CCCCC1 |
| InChI | InChI=1S/C12H19NO/c1-2-3-4-6-9-12(14)13-10-7-5-8-11-13/h2,6,9H,1,3-5,7-8,10-11H2/b9-6+ |
| InChIKey | NFWAEARTBPLLLQ-RMKNXTFCSA-N |
| XLogP | 2.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-1-piperidin-1-ylhepta-2,6-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-1-piperidin-1-ylhepta-2,6-dien-1-one?
The IUPAC name of (2E)-1-piperidin-1-ylhepta-2,6-dien-1-one (CID 90335627) is (2E)-1-piperidin-1-ylhepta-2,6-dien-1-one.
What is the SMILES notation for (2E)-1-piperidin-1-ylhepta-2,6-dien-1-one?
The canonical SMILES for (2E)-1-piperidin-1-ylhepta-2,6-dien-1-one is C=CCC/C=C/C(=O)N1CCCCC1.
What is the InChIKey of (2E)-1-piperidin-1-ylhepta-2,6-dien-1-one?
The InChIKey is NFWAEARTBPLLLQ-RMKNXTFCSA-N. The full InChI is InChI=1S/C12H19NO/c1-2-3-4-6-9-12(14)13-10-7-5-8-11-13/h2,6,9H,1,3-5,7-8,10-11H2/b9-6+.
What are the key properties of (2E)-1-piperidin-1-ylhepta-2,6-dien-1-one?
(2E)-1-piperidin-1-ylhepta-2,6-dien-1-one has a molecular weight of 193.29 g/mol, XLogP of 2.52, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-1-piperidin-1-ylhepta-2,6-dien-1-one is sourced from PubChem (CID 90335627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).