C31H48F3N5O5Si — CID 90335858
tert-butyl N-[[4-[11-(methoxymethyl)-10-oxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexyl]methyl]-N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 90335858) has the molecular formula C31H48F3N5O5Si and a molecular weight of 655.84 g/mol. Its IUPAC name is tert-butyl N-[[4-[11-(methoxymethyl)-10-oxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexyl]methyl]-N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | tert-butyl N-[[4-[11-(methoxymethyl)-10-oxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexyl]methyl]-N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 90335858 |
| Molecular Formula | C31H48F3N5O5Si |
| Molecular Weight | 655.84 g/mol |
| Exact Mass | 655.34 |
| IUPAC Name | tert-butyl N-[[4-[11-(methoxymethyl)-10-oxo-5-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl]cyclohexyl]methyl]-N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | COCN1CN(C2CCC(CN(CC(F)(F)F)C(=O)OC(C)(C)C)CC2)c2c(cnc3c2ccn3COCC[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C31H48F3N5O5Si/c1-30(2,3)44-29(41)37(18-31(32,33)34)17-22-8-10-23(11-9-22)39-19-38(20-42-4)28(40)25-16-35-27-24(26(25)39)12-13-36(27)21-43-14-15-45(5,6)7/h12-13,16,22-23H,8-11,14-15,17-21H2,1-7H3 |
| InChIKey | ONGSFEZPZSEQAV-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 89.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.84 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|