C22H31N5S — CID 90335889
1-[4-(11-cyclopropyl-10-methylidene-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl)cyclohexyl]-N-methyl-N-methylsulfanylmethanamine (PubChem CID 90335889) has the molecular formula C22H31N5S and a molecular weight of 397.59 g/mol. Its IUPAC name is 1-[4-(11-cyclopropyl-10-methylidene-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl)cyclohexyl]-N-methyl-N-methylsulfanylmethanamine.
| Compound Name | 1-[4-(11-cyclopropyl-10-methylidene-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl)cyclohexyl]-N-methyl-N-methylsulfanylmethanamine |
|---|---|
| PubChem CID | 90335889 |
| Molecular Formula | C22H31N5S |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 1-[4-(11-cyclopropyl-10-methylidene-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-13-yl)cyclohexyl]-N-methyl-N-methylsulfanylmethanamine |
| SMILES | C=C1c2cnc3[nH]ccc3c2N(C2CCC(CN(C)SC)CC2)CN1C1CC1 |
| InChI | InChI=1S/C22H31N5S/c1-15-20-12-24-22-19(10-11-23-22)21(20)27(14-26(15)17-8-9-17)18-6-4-16(5-7-18)13-25(2)28-3/h10-12,16-18H,1,4-9,13-14H2,2-3H3,(H,23,24) |
| InChIKey | DOVVRPLXQNVNTG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|