C20H22F3N5O2 — CID 90335917
13-[4-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione (PubChem CID 90335917) has the molecular formula C20H22F3N5O2 and a molecular weight of 421.42 g/mol. Its IUPAC name is 13-[4-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 13-[4-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 90335917 |
| Molecular Formula | C20H22F3N5O2 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 13-[4-[[[1-(trifluoromethyl)cyclopropyl]amino]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione |
| SMILES | O=c1[nH]c(=O)n(C2CCC(CNC3(C(F)(F)F)CC3)CC2)c2c1cnc1[nH]ccc12 |
| InChI | InChI=1S/C20H22F3N5O2/c21-20(22,23)19(6-7-19)26-9-11-1-3-12(4-2-11)28-15-13-5-8-24-16(13)25-10-14(15)17(29)27-18(28)30/h5,8,10-12,26H,1-4,6-7,9H2,(H,24,25)(H,27,29,30) |
| InChIKey | KZAALCBMKULVAW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |