C17H26O2 — CID 90336149
[(4R,7S,8S,10S)-5,5,10-trimethyl-8-tetracyclo[6.4.0.02,10.04,7]dodecanyl] acetate (PubChem CID 90336149) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is [(4R,7S,8S,10S)-5,5,10-trimethyl-8-tetracyclo[6.4.0.02,10.04,7]dodecanyl] acetate.
| Compound Name | [(4R,7S,8S,10S)-5,5,10-trimethyl-8-tetracyclo[6.4.0.02,10.04,7]dodecanyl] acetate |
|---|---|
| PubChem CID | 90336149 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | [(4R,7S,8S,10S)-5,5,10-trimethyl-8-tetracyclo[6.4.0.02,10.04,7]dodecanyl] acetate |
| SMILES | CC(=O)O[C@@]12C[C@]3(C)CCC1C3C[C@@H]1[C@@H]2CC1(C)C |
| InChI | InChI=1S/C17H26O2/c1-10(18)19-17-9-16(4)6-5-11(17)13(16)7-12-14(17)8-15(12,2)3/h11-14H,5-9H2,1-4H3/t11?,12-,13?,14+,16+,17+/m1/s1 |
| InChIKey | KJNAVBXJHXTGNN-CXQFTONOSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |