C18H14F3N5O3S — CID 90336359
8-(2-methylperoxyethyl)-6-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]pyrazino[2,3-d]pyridazin-5-one (PubChem CID 90336359) has the molecular formula C18H14F3N5O3S and a molecular weight of 437.40 g/mol. Its IUPAC name is 8-(2-methylperoxyethyl)-6-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]pyrazino[2,3-d]pyridazin-5-one.
| Compound Name | 8-(2-methylperoxyethyl)-6-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]pyrazino[2,3-d]pyridazin-5-one |
|---|---|
| PubChem CID | 90336359 |
| Molecular Formula | C18H14F3N5O3S |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 8-(2-methylperoxyethyl)-6-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]pyrazino[2,3-d]pyridazin-5-one |
| SMILES | COOCCc1nn(Cc2nc3cc(C(F)(F)F)ccc3s2)c(=O)c2nccnc12 |
| InChI | InChI=1S/C18H14F3N5O3S/c1-28-29-7-4-11-15-16(23-6-5-22-15)17(27)26(25-11)9-14-24-12-8-10(18(19,20)21)2-3-13(12)30-14/h2-3,5-6,8H,4,7,9H2,1H3 |
| InChIKey | RLDPHEFWNPAURD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 92.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|