C22H30F6O8S2 — CID 90336540
1,1,2,2,3,3-hexafluoro-3-[4-[5-methyl-5-[(2-methylpropan-2-yl)oxycarbonyl]heptan-2-yl]phenoxy]sulfonylpropane-1-sulfonic acid (PubChem CID 90336540) has the molecular formula C22H30F6O8S2 and a molecular weight of 600.60 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[4-[5-methyl-5-[(2-methylpropan-2-yl)oxycarbonyl]heptan-2-yl]phenoxy]sulfonylpropane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[4-[5-methyl-5-[(2-methylpropan-2-yl)oxycarbonyl]heptan-2-yl]phenoxy]sulfonylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 90336540 |
| Molecular Formula | C22H30F6O8S2 |
| Molecular Weight | 600.60 g/mol |
| Exact Mass | 600.13 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[4-[5-methyl-5-[(2-methylpropan-2-yl)oxycarbonyl]heptan-2-yl]phenoxy]sulfonylpropane-1-sulfonic acid |
| SMILES | CCC(C)(CCC(C)c1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30F6O8S2/c1-7-19(6,17(29)35-18(3,4)5)13-12-14(2)15-8-10-16(11-9-15)36-38(33,34)22(27,28)20(23,24)21(25,26)37(30,31)32/h8-11,14H,7,12-13H2,1-6H3,(H,30,31,32) |
| InChIKey | HQTPOPASMOOTCM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|