About (E)-6-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylhex-3-en-2-one
(E)-6-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylhex-3-en-2-one (PubChem CID 90336562) has the molecular formula C12H13F5OS2
and a molecular weight of 332.36 g/mol. Its IUPAC name is (E)-6-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylhex-3-en-2-one.
Molecular Properties
| Compound Name | (E)-6-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylhex-3-en-2-one |
| PubChem CID | 90336562 |
| Molecular Formula | C12H13F5OS2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | (E)-6-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylhex-3-en-2-one |
| SMILES | CC(=O)/C=C/CCSc1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F5OS2/c1-10(18)4-2-3-9-19-11-5-7-12(8-6-11)20(13,14,15,16)17/h2,4-8H,3,9H2,1H3/b4-2+ |
| InChIKey | DMYWZRZOYPJTRX-DUXPYHPUSA-N |
| XLogP | 5.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylhex-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylhex-3-en-2-one?
The IUPAC name of (E)-6-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylhex-3-en-2-one (CID 90336562) is (E)-6-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylhex-3-en-2-one.
What is the SMILES notation for (E)-6-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylhex-3-en-2-one?
The canonical SMILES for (E)-6-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylhex-3-en-2-one is CC(=O)/C=C/CCSc1ccc(S(F)(F)(F)(F)F)cc1.
What is the InChIKey of (E)-6-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylhex-3-en-2-one?
The InChIKey is DMYWZRZOYPJTRX-DUXPYHPUSA-N. The full InChI is InChI=1S/C12H13F5OS2/c1-10(18)4-2-3-9-19-11-5-7-12(8-6-11)20(13,14,15,16)17/h2,4-8H,3,9H2,1H3/b4-2+.
What are the key properties of (E)-6-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylhex-3-en-2-one?
(E)-6-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylhex-3-en-2-one has a molecular weight of 332.36 g/mol, XLogP of 5.97, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-[4-(pentafluoro-λ6-sulfanyl)phenyl]sulfanylhex-3-en-2-one is sourced from PubChem (CID 90336562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).