C14H26N2O — CID 90336575
3-tert-butyl-5-(5,5-dimethylhexyl)-1,2,4-oxadiazole (PubChem CID 90336575) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 3-tert-butyl-5-(5,5-dimethylhexyl)-1,2,4-oxadiazole.
| Compound Name | 3-tert-butyl-5-(5,5-dimethylhexyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 90336575 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 3-tert-butyl-5-(5,5-dimethylhexyl)-1,2,4-oxadiazole |
| SMILES | CC(C)(C)CCCCc1nc(C(C)(C)C)no1 |
| InChI | InChI=1S/C14H26N2O/c1-13(2,3)10-8-7-9-11-15-12(16-17-11)14(4,5)6/h7-10H2,1-6H3 |
| InChIKey | LWUNFKDPSWVVHD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|