C36H34N4 — CID 90336854
9,9,23,23-tetramethyl-13,27-di(propan-2-yl)-4,6,18,20-tetrazaoctacyclo[13.13.2.02,10.03,8.012,29.016,24.017,22.026,30]triaconta-1,3,5,7,10,12,14,16(24),17,19,21,25,27,29-tetradecaene (PubChem CID 90336854) has the molecular formula C36H34N4 and a molecular weight of 522.70 g/mol. Its IUPAC name is 9,9,23,23-tetramethyl-13,27-di(propan-2-yl)-4,6,18,20-tetrazaoctacyclo[13.13.2.02,10.03,8.012,29.016,24.017,22.026,30]triaconta-1,3,5,7,10,12,14,16(24),17,19,21,25,27,29-tetradecaene.
| Compound Name | 9,9,23,23-tetramethyl-13,27-di(propan-2-yl)-4,6,18,20-tetrazaoctacyclo[13.13.2.02,10.03,8.012,29.016,24.017,22.026,30]triaconta-1,3,5,7,10,12,14,16(24),17,19,21,25,27,29-tetradecaene |
|---|---|
| PubChem CID | 90336854 |
| Molecular Formula | C36H34N4 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | 9,9,23,23-tetramethyl-13,27-di(propan-2-yl)-4,6,18,20-tetrazaoctacyclo[13.13.2.02,10.03,8.012,29.016,24.017,22.026,30]triaconta-1,3,5,7,10,12,14,16(24),17,19,21,25,27,29-tetradecaene |
| SMILES | CC(C)c1cc2c3c(cc4c(C(C)C)cc5c6c(cc1c5c42)C(C)(C)c1cncnc1-6)C(C)(C)c1cncnc1-3 |
| InChI | InChI=1S/C36H34N4/c1-17(2)19-9-23-30-22(12-26-31(23)33-27(36(26,7)8)13-37-15-39-33)20(18(3)4)10-24-29(30)21(19)11-25-32(24)34-28(35(25,5)6)14-38-16-40-34/h9-18H,1-8H3 |
| InChIKey | TXUALZSEAOKRRG-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|