C26H29FN4O4 — CID 90337731
2-[3-[4-(4-fluoro-3-methylanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-1,3,3a,6,7,7a-hexahydropyrano[3,4-c]pyrrol-4-one (PubChem CID 90337731) has the molecular formula C26H29FN4O4 and a molecular weight of 480.54 g/mol. Its IUPAC name is 2-[3-[4-(4-fluoro-3-methylanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-1,3,3a,6,7,7a-hexahydropyrano[3,4-c]pyrrol-4-one.
| Compound Name | 2-[3-[4-(4-fluoro-3-methylanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-1,3,3a,6,7,7a-hexahydropyrano[3,4-c]pyrrol-4-one |
|---|---|
| PubChem CID | 90337731 |
| Molecular Formula | C26H29FN4O4 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 2-[3-[4-(4-fluoro-3-methylanilino)-7-methoxyquinazolin-6-yl]oxypropyl]-1,3,3a,6,7,7a-hexahydropyrano[3,4-c]pyrrol-4-one |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(C)c3)c2cc1OCCCN1CC2CCOC(=O)C2C1 |
| InChI | InChI=1S/C26H29FN4O4/c1-16-10-18(4-5-21(16)27)30-25-19-11-24(23(33-2)12-22(19)28-15-29-25)34-8-3-7-31-13-17-6-9-35-26(32)20(17)14-31/h4-5,10-12,15,17,20H,3,6-9,13-14H2,1-2H3,(H,28,29,30) |
| InChIKey | ULAAVKHTEJETTC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|