methyl 6-bromo-2,3-dihydropyridine-4-carboxylate

C7H8BrNO2 — CID 90338022

IUPACmethyl 6-bromo-2,3-dihydropyridine-4-carboxylate
SMILESCOC(=O)C1=CC(Br)=NCC1
InChIInChI=1S/C7H8BrNO2/c1-11-7(10)5-2-3-9-6(8)4-5/h4H,2-3H2,1H3
InChIKeyFJDNGPBCYKKQPF-UHFFFAOYSA-N
MW218.05 g/mol
LogP1.28
Rot. Bonds1

About methyl 6-bromo-2,3-dihydropyridine-4-carboxylate

methyl 6-bromo-2,3-dihydropyridine-4-carboxylate (PubChem CID 90338022) has the molecular formula C7H8BrNO2 and a molecular weight of 218.05 g/mol. Its IUPAC name is methyl 6-bromo-2,3-dihydropyridine-4-carboxylate.

Molecular Properties

Compound Namemethyl 6-bromo-2,3-dihydropyridine-4-carboxylate
PubChem CID90338022
Molecular FormulaC7H8BrNO2
Molecular Weight218.05 g/mol
Exact Mass216.97
IUPAC Namemethyl 6-bromo-2,3-dihydropyridine-4-carboxylate
SMILESCOC(=O)C1=CC(Br)=NCC1
InChIInChI=1S/C7H8BrNO2/c1-11-7(10)5-2-3-9-6(8)4-5/h4H,2-3H2,1H3
InChIKeyFJDNGPBCYKKQPF-UHFFFAOYSA-N
XLogP1.28
TPSA38.66 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.05
LogP ≤ 51.28
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 6-bromo-2,3-dihydropyridine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-bromo-2,3-dihydropyridine-4-carboxylate?
The IUPAC name of methyl 6-bromo-2,3-dihydropyridine-4-carboxylate (CID 90338022) is methyl 6-bromo-2,3-dihydropyridine-4-carboxylate.
What is the SMILES notation for methyl 6-bromo-2,3-dihydropyridine-4-carboxylate?
The canonical SMILES for methyl 6-bromo-2,3-dihydropyridine-4-carboxylate is COC(=O)C1=CC(Br)=NCC1.
What is the InChIKey of methyl 6-bromo-2,3-dihydropyridine-4-carboxylate?
The InChIKey is FJDNGPBCYKKQPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrNO2/c1-11-7(10)5-2-3-9-6(8)4-5/h4H,2-3H2,1H3.
What are the key properties of methyl 6-bromo-2,3-dihydropyridine-4-carboxylate?
methyl 6-bromo-2,3-dihydropyridine-4-carboxylate has a molecular weight of 218.05 g/mol, XLogP of 1.28, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-bromo-2,3-dihydropyridine-4-carboxylate is sourced from PubChem (CID 90338022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).