C6H10O5 — CID 90338107
(3R,5S)-3,4,5-trihydroxy-6-methyloxan-2-one (PubChem CID 90338107) has the molecular formula C6H10O5 and a molecular weight of 162.14 g/mol. Its IUPAC name is (3R,5S)-3,4,5-trihydroxy-6-methyloxan-2-one.
| Compound Name | (3R,5S)-3,4,5-trihydroxy-6-methyloxan-2-one |
|---|---|
| PubChem CID | 90338107 |
| Molecular Formula | C6H10O5 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | (3R,5S)-3,4,5-trihydroxy-6-methyloxan-2-one |
| SMILES | CC1OC(=O)[C@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C6H10O5/c1-2-3(7)4(8)5(9)6(10)11-2/h2-5,7-9H,1H3/t2?,3-,4?,5-/m1/s1 |
| InChIKey | ZVAHHEYPLKVJSO-FKEBYDFPSA-N |
| XLogP | -1.99 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |