C17H11F7N2OS — CID 90338146
2-(3-ethylsulfanyl-2-pyridinyl)-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-benzoxazole (PubChem CID 90338146) has the molecular formula C17H11F7N2OS and a molecular weight of 424.34 g/mol. Its IUPAC name is 2-(3-ethylsulfanyl-2-pyridinyl)-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-benzoxazole.
| Compound Name | 2-(3-ethylsulfanyl-2-pyridinyl)-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 90338146 |
| Molecular Formula | C17H11F7N2OS |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 2-(3-ethylsulfanyl-2-pyridinyl)-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-benzoxazole |
| SMILES | CCSc1cccnc1-c1nc2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2o1 |
| InChI | InChI=1S/C17H11F7N2OS/c1-2-28-12-4-3-7-25-13(12)14-26-10-6-5-9(8-11(10)27-14)15(18,16(19,20)21)17(22,23)24/h3-8H,2H2,1H3 |
| InChIKey | UNQKKEJVBPJTLK-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |