C30H33ClF3N7O4 — CID 90339053
tert-butyl N-[3-[N-acetyl-4-[[5-chloro-4-[2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]-3-(trifluoromethyl)anilino]propyl]carbamate (PubChem CID 90339053) has the molecular formula C30H33ClF3N7O4 and a molecular weight of 648.09 g/mol. Its IUPAC name is tert-butyl N-[3-[N-acetyl-4-[[5-chloro-4-[2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]-3-(trifluoromethyl)anilino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[N-acetyl-4-[[5-chloro-4-[2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]-3-(trifluoromethyl)anilino]propyl]carbamate |
|---|---|
| PubChem CID | 90339053 |
| Molecular Formula | C30H33ClF3N7O4 |
| Molecular Weight | 648.09 g/mol |
| Exact Mass | 647.22 |
| IUPAC Name | tert-butyl N-[3-[N-acetyl-4-[[5-chloro-4-[2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]-3-(trifluoromethyl)anilino]propyl]carbamate |
| SMILES | C=CC(=O)Nc1ccccc1Nc1nc(Nc2ccc(N(CCCNC(=O)OC(C)(C)C)C(C)=O)cc2C(F)(F)F)ncc1Cl |
| InChI | InChI=1S/C30H33ClF3N7O4/c1-6-25(43)37-23-10-7-8-11-24(23)38-26-21(31)17-36-27(40-26)39-22-13-12-19(16-20(22)30(32,33)34)41(18(2)42)15-9-14-35-28(44)45-29(3,4)5/h6-8,10-13,16-17H,1,9,14-15H2,2-5H3,(H,35,44)(H,37,43)(H2,36,38,39,40) |
| InChIKey | OUSCYWNOXJHJRL-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 137.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.09 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|