C12H15F3N2O2 — CID 90340109
1-methyl-2-[2,2,2-trifluoro-1-[methyl(prop-2-ynyl)amino]ethyl]-2H-pyridine-3,4-diol (PubChem CID 90340109) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 1-methyl-2-[2,2,2-trifluoro-1-[methyl(prop-2-ynyl)amino]ethyl]-2H-pyridine-3,4-diol.
| Compound Name | 1-methyl-2-[2,2,2-trifluoro-1-[methyl(prop-2-ynyl)amino]ethyl]-2H-pyridine-3,4-diol |
|---|---|
| PubChem CID | 90340109 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-methyl-2-[2,2,2-trifluoro-1-[methyl(prop-2-ynyl)amino]ethyl]-2H-pyridine-3,4-diol |
| SMILES | C#CCN(C)C(C1C(O)=C(O)C=CN1C)C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O2/c1-4-6-17(3)11(12(13,14)15)9-10(19)8(18)5-7-16(9)2/h1,5,7,9,11,18-19H,6H2,2-3H3 |
| InChIKey | IRVGCTWKRKNSON-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|