C28H30N2O3 — CID 90340119
(1S,2R,6S,12R,13R,14S,16R)-14-amino-5-isoquinolin-7-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol (PubChem CID 90340119) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is (1S,2R,6S,12R,13R,14S,16R)-14-amino-5-isoquinolin-7-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol.
| Compound Name | (1S,2R,6S,12R,13R,14S,16R)-14-amino-5-isoquinolin-7-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
|---|---|
| PubChem CID | 90340119 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | (1S,2R,6S,12R,13R,14S,16R)-14-amino-5-isoquinolin-7-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
| SMILES | C[C@]12CC=C3C=C4[C@@H](O)[C@H](O)[C@@H](N)C[C@]45CC[C@]3(O5)[C@@H]1CC=C2c1ccc2ccncc2c1 |
| InChI | InChI=1S/C28H30N2O3/c1-26-8-6-19-13-21-24(31)25(32)22(29)14-27(21)9-10-28(19,33-27)23(26)5-4-20(26)17-3-2-16-7-11-30-15-18(16)12-17/h2-4,6-7,11-13,15,22-25,31-32H,5,8-10,14,29H2,1H3/t22-,23+,24+,25+,26+,27+,28+/m0/s1 |
| InChIKey | RDKBZHQNPDQDGF-PGZRKTTBSA-N |
| XLogP | 3.66 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |