C31H39N3O3 — CID 90340552
(1S,6R,12R,13R,14S,16R)-14-(dimethylamino)-6,7,7-trimethyl-5-(3-methyl-2H-indazol-5-yl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol (PubChem CID 90340552) has the molecular formula C31H39N3O3 and a molecular weight of 501.67 g/mol. Its IUPAC name is (1S,6R,12R,13R,14S,16R)-14-(dimethylamino)-6,7,7-trimethyl-5-(3-methyl-2H-indazol-5-yl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol.
| Compound Name | (1S,6R,12R,13R,14S,16R)-14-(dimethylamino)-6,7,7-trimethyl-5-(3-methyl-2H-indazol-5-yl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
|---|---|
| PubChem CID | 90340552 |
| Molecular Formula | C31H39N3O3 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.30 |
| IUPAC Name | (1S,6R,12R,13R,14S,16R)-14-(dimethylamino)-6,7,7-trimethyl-5-(3-methyl-2H-indazol-5-yl)-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-12,13-diol |
| SMILES | Cc1[nH]nc2ccc(C3=CCC4[C@@]56CC[C@]7(C[C@H](N(C)C)[C@@H](O)[C@H](O)C7=CC5=CC(C)(C)[C@]34C)O6)cc12 |
| InChI | InChI=1S/C31H39N3O3/c1-17-20-13-18(7-9-23(20)33-32-17)21-8-10-25-29(21,4)28(2,3)15-19-14-22-26(35)27(36)24(34(5)6)16-30(22)11-12-31(19,25)37-30/h7-9,13-15,24-27,35-36H,10-12,16H2,1-6H3,(H,32,33)/t24-,25?,26+,27+,29+,30+,31+/m0/s1 |
| InChIKey | SJJOXVKKECZOTC-VJNXLZOSSA-N |
| XLogP | 4.53 |
| TPSA | 81.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |