C29H33N3O3 — CID 90340602
(1S,6S,12R,13R,14S,16R)-5-(4-cyanophenyl)-14-(dimethylamino)-12,13-dihydroxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,10-diene-9-carbonitrile (PubChem CID 90340602) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is (1S,6S,12R,13R,14S,16R)-5-(4-cyanophenyl)-14-(dimethylamino)-12,13-dihydroxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,10-diene-9-carbonitrile.
| Compound Name | (1S,6S,12R,13R,14S,16R)-5-(4-cyanophenyl)-14-(dimethylamino)-12,13-dihydroxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,10-diene-9-carbonitrile |
|---|---|
| PubChem CID | 90340602 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | (1S,6S,12R,13R,14S,16R)-5-(4-cyanophenyl)-14-(dimethylamino)-12,13-dihydroxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,10-diene-9-carbonitrile |
| SMILES | CN(C)[C@H]1C[C@@]23CC[C@]4(O2)C2CC=C(c5ccc(C#N)cc5)[C@@]2(C)CCC4(C#N)C=C3[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H33N3O3/c1-26-10-11-27(17-31)14-21-24(33)25(34)22(32(2)3)15-28(21)12-13-29(27,35-28)23(26)9-8-20(26)19-6-4-18(16-30)5-7-19/h4-8,14,22-25,33-34H,9-13,15H2,1-3H3/t22-,23?,24+,25+,26+,27?,28+,29-/m0/s1 |
| InChIKey | RAHATPDQOLNFKT-UGSOIZFJSA-N |
| XLogP | 3.56 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|