C28H33FN2O3 — CID 90340844
4-[(1S,6S,12S,13R,14S,16R)-14-(dimethylamino)-11-fluoro-12,13-dihydroxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8-dien-5-yl]benzonitrile (PubChem CID 90340844) has the molecular formula C28H33FN2O3 and a molecular weight of 464.58 g/mol. Its IUPAC name is 4-[(1S,6S,12S,13R,14S,16R)-14-(dimethylamino)-11-fluoro-12,13-dihydroxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8-dien-5-yl]benzonitrile.
| Compound Name | 4-[(1S,6S,12S,13R,14S,16R)-14-(dimethylamino)-11-fluoro-12,13-dihydroxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8-dien-5-yl]benzonitrile |
|---|---|
| PubChem CID | 90340844 |
| Molecular Formula | C28H33FN2O3 |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 4-[(1S,6S,12S,13R,14S,16R)-14-(dimethylamino)-11-fluoro-12,13-dihydroxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8-dien-5-yl]benzonitrile |
| SMILES | CN(C)[C@H]1C[C@@]23CC[C@@]4(O2)C(=CC[C@]2(C)C(c5ccc(C#N)cc5)=CCC24)CC3(F)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H33FN2O3/c1-25-11-10-19-14-28(29)24(33)23(32)21(31(2)3)15-26(28)12-13-27(19,34-26)22(25)9-8-20(25)18-6-4-17(16-30)5-7-18/h4-8,10,21-24,32-33H,9,11-15H2,1-3H3/t21-,22?,23+,24-,25+,26+,27+,28?/m0/s1 |
| InChIKey | JAWGYBJOAYCLDI-ZRMFVCGPSA-N |
| XLogP | 3.75 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|