C30H38N2O4 — CID 90340903
(1S,6S,12R,13R,14S,16R)-14-(dimethylamino)-5-isoquinolin-8-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadec-4-ene-9,12,13-triol (PubChem CID 90340903) has the molecular formula C30H38N2O4 and a molecular weight of 490.64 g/mol. Its IUPAC name is (1S,6S,12R,13R,14S,16R)-14-(dimethylamino)-5-isoquinolin-8-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadec-4-ene-9,12,13-triol.
| Compound Name | (1S,6S,12R,13R,14S,16R)-14-(dimethylamino)-5-isoquinolin-8-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadec-4-ene-9,12,13-triol |
|---|---|
| PubChem CID | 90340903 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | (1S,6S,12R,13R,14S,16R)-14-(dimethylamino)-5-isoquinolin-8-yl-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadec-4-ene-9,12,13-triol |
| SMILES | CN(C)[C@H]1C[C@@]23CC[C@]4(O2)C2CC=C(c5cccc6ccncc56)[C@@]2(C)CCC4(O)CC3[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H38N2O4/c1-27-10-12-29(35)15-22-25(33)26(34)23(32(2)3)16-28(22)11-13-30(29,36-28)24(27)8-7-21(27)19-6-4-5-18-9-14-31-17-20(18)19/h4-7,9,14,17,22-26,33-35H,8,10-13,15-16H2,1-3H3/t22?,23-,24?,25+,26+,27+,28+,29?,30-/m0/s1 |
| InChIKey | XPESPZLMWFWGTF-RJOYRUOZSA-N |
| XLogP | 3.53 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |