C18H16Br2ClNS — CID 90342758
3-[2-(3,5-dibromophenyl)-6-methylphenyl]-4,5-dimethyl-1,3-thiazol-3-ium chloride (PubChem CID 90342758) has the molecular formula C18H16Br2ClNS and a molecular weight of 473.66 g/mol. Its IUPAC name is 3-[2-(3,5-dibromophenyl)-6-methylphenyl]-4,5-dimethyl-1,3-thiazol-3-ium chloride.
| Compound Name | 3-[2-(3,5-dibromophenyl)-6-methylphenyl]-4,5-dimethyl-1,3-thiazol-3-ium chloride |
|---|---|
| PubChem CID | 90342758 |
| Molecular Formula | C18H16Br2ClNS |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 470.91 |
| IUPAC Name | 3-[2-(3,5-dibromophenyl)-6-methylphenyl]-4,5-dimethyl-1,3-thiazol-3-ium chloride |
| SMILES | Cc1cccc(-c2cc(Br)cc(Br)c2)c1-[n+]1csc(C)c1C.[Cl-] |
| InChI | InChI=1S/C18H16Br2NS.ClH/c1-11-5-4-6-17(14-7-15(19)9-16(20)8-14)18(11)21-10-22-13(3)12(21)2;/h4-10H,1-3H3;1H/q+1;/p-1 |
| InChIKey | JCBAUIPCWPWNPG-UHFFFAOYSA-M |
| XLogP | 3.15 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|