About methyl 2-sulfanylundecanoate
methyl 2-sulfanylundecanoate (PubChem CID 90343263) has the molecular formula C12H24O2S
and a molecular weight of 232.39 g/mol. Its IUPAC name is methyl 2-sulfanylundecanoate.
Molecular Properties
| Compound Name | methyl 2-sulfanylundecanoate |
| PubChem CID | 90343263 |
| Molecular Formula | C12H24O2S |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | methyl 2-sulfanylundecanoate |
| SMILES | CCCCCCCCCC(S)C(=O)OC |
| InChI | InChI=1S/C12H24O2S/c1-3-4-5-6-7-8-9-10-11(15)12(13)14-2/h11,15H,3-10H2,1-2H3 |
| InChIKey | DLARJFAXCJOJSN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-sulfanylundecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-sulfanylundecanoate?
The IUPAC name of methyl 2-sulfanylundecanoate (CID 90343263) is methyl 2-sulfanylundecanoate.
What is the SMILES notation for methyl 2-sulfanylundecanoate?
The canonical SMILES for methyl 2-sulfanylundecanoate is CCCCCCCCCC(S)C(=O)OC.
What is the InChIKey of methyl 2-sulfanylundecanoate?
The InChIKey is DLARJFAXCJOJSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2S/c1-3-4-5-6-7-8-9-10-11(15)12(13)14-2/h11,15H,3-10H2,1-2H3.
What are the key properties of methyl 2-sulfanylundecanoate?
methyl 2-sulfanylundecanoate has a molecular weight of 232.39 g/mol, XLogP of 3.60, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-sulfanylundecanoate is sourced from PubChem (CID 90343263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).