C12H14F3NO3S2 — CID 9034328
3-[2-[3-(trifluoromethyl)phenyl]sulfanylethylsulfonyl]propanamide (PubChem CID 9034328) has the molecular formula C12H14F3NO3S2 and a molecular weight of 341.38 g/mol. Its IUPAC name is 3-[2-[3-(trifluoromethyl)phenyl]sulfanylethylsulfonyl]propanamide.
| Compound Name | 3-[2-[3-(trifluoromethyl)phenyl]sulfanylethylsulfonyl]propanamide |
|---|---|
| PubChem CID | 9034328 |
| Molecular Formula | C12H14F3NO3S2 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 3-[2-[3-(trifluoromethyl)phenyl]sulfanylethylsulfonyl]propanamide |
| SMILES | NC(=O)CCS(=O)(=O)CCSc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO3S2/c13-12(14,15)9-2-1-3-10(8-9)20-5-7-21(18,19)6-4-11(16)17/h1-3,8H,4-7H2,(H2,16,17) |
| InChIKey | XOFLUFDUWBYSHF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |