About 1-aminotetradecan-2-yl 2-aminoacetate
1-aminotetradecan-2-yl 2-aminoacetate (PubChem CID 90343536) has the molecular formula C16H34N2O2
and a molecular weight of 286.46 g/mol. Its IUPAC name is 1-aminotetradecan-2-yl 2-aminoacetate.
Molecular Properties
| Compound Name | 1-aminotetradecan-2-yl 2-aminoacetate |
| PubChem CID | 90343536 |
| Molecular Formula | C16H34N2O2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.26 |
| IUPAC Name | 1-aminotetradecan-2-yl 2-aminoacetate |
| SMILES | CCCCCCCCCCCCC(CN)OC(=O)CN |
| InChI | InChI=1S/C16H34N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-15(13-17)20-16(19)14-18/h15H,2-14,17-18H2,1H3 |
| InChIKey | MUOJJQQYEZPUDC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-aminotetradecan-2-yl 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminotetradecan-2-yl 2-aminoacetate?
The IUPAC name of 1-aminotetradecan-2-yl 2-aminoacetate (CID 90343536) is 1-aminotetradecan-2-yl 2-aminoacetate.
What is the SMILES notation for 1-aminotetradecan-2-yl 2-aminoacetate?
The canonical SMILES for 1-aminotetradecan-2-yl 2-aminoacetate is CCCCCCCCCCCCC(CN)OC(=O)CN.
What is the InChIKey of 1-aminotetradecan-2-yl 2-aminoacetate?
The InChIKey is MUOJJQQYEZPUDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-15(13-17)20-16(19)14-18/h15H,2-14,17-18H2,1H3.
What are the key properties of 1-aminotetradecan-2-yl 2-aminoacetate?
1-aminotetradecan-2-yl 2-aminoacetate has a molecular weight of 286.46 g/mol, XLogP of 3.13, 14 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminotetradecan-2-yl 2-aminoacetate is sourced from PubChem (CID 90343536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).