About 3-(ethyliminomethylideneamino)-3-(1-hydroxybenzotriazol-4-yl)-N,N-dimethylpropan-1-amine
3-(ethyliminomethylideneamino)-3-(1-hydroxybenzotriazol-4-yl)-N,N-dimethylpropan-1-amine (PubChem CID 90344398) has the molecular formula C14H20N6O
and a molecular weight of 288.36 g/mol. Its IUPAC name is 3-(ethyliminomethylideneamino)-3-(1-hydroxybenzotriazol-4-yl)-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(ethyliminomethylideneamino)-3-(1-hydroxybenzotriazol-4-yl)-N,N-dimethylpropan-1-amine |
| PubChem CID | 90344398 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 3-(ethyliminomethylideneamino)-3-(1-hydroxybenzotriazol-4-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CCN=C=NC(CCN(C)C)c1cccc2c1nnn2O |
| InChI | InChI=1S/C14H20N6O/c1-4-15-10-16-12(8-9-19(2)3)11-6-5-7-13-14(11)17-18-20(13)21/h5-7,12,21H,4,8-9H2,1-3H3 |
| InChIKey | CQGBGGGRFHQFIG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-(ethyliminomethylideneamino)-3-(1-hydroxybenzotriazol-4-yl)-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethyliminomethylideneamino)-3-(1-hydroxybenzotriazol-4-yl)-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-(ethyliminomethylideneamino)-3-(1-hydroxybenzotriazol-4-yl)-N,N-dimethylpropan-1-amine (CID 90344398) is 3-(ethyliminomethylideneamino)-3-(1-hydroxybenzotriazol-4-yl)-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-(ethyliminomethylideneamino)-3-(1-hydroxybenzotriazol-4-yl)-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-(ethyliminomethylideneamino)-3-(1-hydroxybenzotriazol-4-yl)-N,N-dimethylpropan-1-amine is CCN=C=NC(CCN(C)C)c1cccc2c1nnn2O.
What is the InChIKey of 3-(ethyliminomethylideneamino)-3-(1-hydroxybenzotriazol-4-yl)-N,N-dimethylpropan-1-amine?
The InChIKey is CQGBGGGRFHQFIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N6O/c1-4-15-10-16-12(8-9-19(2)3)11-6-5-7-13-14(11)17-18-20(13)21/h5-7,12,21H,4,8-9H2,1-3H3.
What are the key properties of 3-(ethyliminomethylideneamino)-3-(1-hydroxybenzotriazol-4-yl)-N,N-dimethylpropan-1-amine?
3-(ethyliminomethylideneamino)-3-(1-hydroxybenzotriazol-4-yl)-N,N-dimethylpropan-1-amine has a molecular weight of 288.36 g/mol, XLogP of 1.86, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethyliminomethylideneamino)-3-(1-hydroxybenzotriazol-4-yl)-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 90344398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).