About 2,6-dichloro-4-(2,6-dichlorophenyl)sulfanylaniline
2,6-dichloro-4-(2,6-dichlorophenyl)sulfanylaniline (PubChem CID 90344489) has the molecular formula C12H7Cl4NS
and a molecular weight of 339.07 g/mol. Its IUPAC name is 2,6-dichloro-4-(2,6-dichlorophenyl)sulfanylaniline.
Molecular Properties
| Compound Name | 2,6-dichloro-4-(2,6-dichlorophenyl)sulfanylaniline |
| PubChem CID | 90344489 |
| Molecular Formula | C12H7Cl4NS |
| Molecular Weight | 339.07 g/mol |
| Exact Mass | 336.91 |
| IUPAC Name | 2,6-dichloro-4-(2,6-dichlorophenyl)sulfanylaniline |
| SMILES | Nc1c(Cl)cc(Sc2c(Cl)cccc2Cl)cc1Cl |
| InChI | InChI=1S/C12H7Cl4NS/c13-7-2-1-3-8(14)12(7)18-6-4-9(15)11(17)10(16)5-6/h1-5H,17H2 |
| InChIKey | IIRPPVSSBDCCAN-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.07 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichloro-4-(2,6-dichlorophenyl)sulfanylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-4-(2,6-dichlorophenyl)sulfanylaniline?
The IUPAC name of 2,6-dichloro-4-(2,6-dichlorophenyl)sulfanylaniline (CID 90344489) is 2,6-dichloro-4-(2,6-dichlorophenyl)sulfanylaniline.
What is the SMILES notation for 2,6-dichloro-4-(2,6-dichlorophenyl)sulfanylaniline?
The canonical SMILES for 2,6-dichloro-4-(2,6-dichlorophenyl)sulfanylaniline is Nc1c(Cl)cc(Sc2c(Cl)cccc2Cl)cc1Cl.
What is the InChIKey of 2,6-dichloro-4-(2,6-dichlorophenyl)sulfanylaniline?
The InChIKey is IIRPPVSSBDCCAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Cl4NS/c13-7-2-1-3-8(14)12(7)18-6-4-9(15)11(17)10(16)5-6/h1-5H,17H2.
What are the key properties of 2,6-dichloro-4-(2,6-dichlorophenyl)sulfanylaniline?
2,6-dichloro-4-(2,6-dichlorophenyl)sulfanylaniline has a molecular weight of 339.07 g/mol, XLogP of 6.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-4-(2,6-dichlorophenyl)sulfanylaniline is sourced from PubChem (CID 90344489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).