About 2-(1-azatricyclo[3.3.1.13,7]decan-2-yl)ethanamine
2-(1-azatricyclo[3.3.1.13,7]decan-2-yl)ethanamine (PubChem CID 90344511) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 2-(1-azatricyclo[3.3.1.13,7]decan-2-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(1-azatricyclo[3.3.1.13,7]decan-2-yl)ethanamine |
| PubChem CID | 90344511 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 2-(1-azatricyclo[3.3.1.13,7]decan-2-yl)ethanamine |
| SMILES | NCCC1C2CC3CC(C2)CN1C3 |
| InChI | InChI=1S/C11H20N2/c12-2-1-11-10-4-8-3-9(5-10)7-13(11)6-8/h8-11H,1-7,12H2 |
| InChIKey | YLHMHNBYFBSYCY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-azatricyclo[3.3.1.13,7]decan-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-azatricyclo[3.3.1.13,7]decan-2-yl)ethanamine?
The IUPAC name of 2-(1-azatricyclo[3.3.1.13,7]decan-2-yl)ethanamine (CID 90344511) is 2-(1-azatricyclo[3.3.1.13,7]decan-2-yl)ethanamine.
What is the SMILES notation for 2-(1-azatricyclo[3.3.1.13,7]decan-2-yl)ethanamine?
The canonical SMILES for 2-(1-azatricyclo[3.3.1.13,7]decan-2-yl)ethanamine is NCCC1C2CC3CC(C2)CN1C3.
What is the InChIKey of 2-(1-azatricyclo[3.3.1.13,7]decan-2-yl)ethanamine?
The InChIKey is YLHMHNBYFBSYCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c12-2-1-11-10-4-8-3-9(5-10)7-13(11)6-8/h8-11H,1-7,12H2.
What are the key properties of 2-(1-azatricyclo[3.3.1.13,7]decan-2-yl)ethanamine?
2-(1-azatricyclo[3.3.1.13,7]decan-2-yl)ethanamine has a molecular weight of 180.29 g/mol, XLogP of 1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-azatricyclo[3.3.1.13,7]decan-2-yl)ethanamine is sourced from PubChem (CID 90344511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).