About 5-benzyl-1H-1,2,4-triazole-3-carboxylic acid
5-benzyl-1H-1,2,4-triazole-3-carboxylic acid (PubChem CID 90345164) has the molecular formula C10H9N3O2
and a molecular weight of 203.20 g/mol. Its IUPAC name is 5-benzyl-1H-1,2,4-triazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-benzyl-1H-1,2,4-triazole-3-carboxylic acid |
| PubChem CID | 90345164 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 5-benzyl-1H-1,2,4-triazole-3-carboxylic acid |
| SMILES | O=C(O)c1n[nH]c(Cc2ccccc2)n1 |
| InChI | InChI=1S/C10H9N3O2/c14-10(15)9-11-8(12-13-9)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,14,15)(H,11,12,13) |
| InChIKey | WTZOKLZJHWSCBN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-benzyl-1H-1,2,4-triazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-1H-1,2,4-triazole-3-carboxylic acid?
The IUPAC name of 5-benzyl-1H-1,2,4-triazole-3-carboxylic acid (CID 90345164) is 5-benzyl-1H-1,2,4-triazole-3-carboxylic acid.
What is the SMILES notation for 5-benzyl-1H-1,2,4-triazole-3-carboxylic acid?
The canonical SMILES for 5-benzyl-1H-1,2,4-triazole-3-carboxylic acid is O=C(O)c1n[nH]c(Cc2ccccc2)n1.
What is the InChIKey of 5-benzyl-1H-1,2,4-triazole-3-carboxylic acid?
The InChIKey is WTZOKLZJHWSCBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2/c14-10(15)9-11-8(12-13-9)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,14,15)(H,11,12,13).
What are the key properties of 5-benzyl-1H-1,2,4-triazole-3-carboxylic acid?
5-benzyl-1H-1,2,4-triazole-3-carboxylic acid has a molecular weight of 203.20 g/mol, XLogP of 1.09, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-1H-1,2,4-triazole-3-carboxylic acid is sourced from PubChem (CID 90345164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).