C24H18F8 — CID 90345716
1-(3,3-dimethylbut-1-ynyl)-4-[4-(3,3-dimethylbut-1-ynyl)-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorobenzene (PubChem CID 90345716) has the molecular formula C24H18F8 and a molecular weight of 458.39 g/mol. Its IUPAC name is 1-(3,3-dimethylbut-1-ynyl)-4-[4-(3,3-dimethylbut-1-ynyl)-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorobenzene.
| Compound Name | 1-(3,3-dimethylbut-1-ynyl)-4-[4-(3,3-dimethylbut-1-ynyl)-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 90345716 |
| Molecular Formula | C24H18F8 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 1-(3,3-dimethylbut-1-ynyl)-4-[4-(3,3-dimethylbut-1-ynyl)-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorobenzene |
| SMILES | CC(C)(C)C#Cc1c(F)c(F)c(-c2c(F)c(F)c(C#CC(C)(C)C)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24H18F8/c1-23(2,3)9-7-11-15(25)19(29)13(20(30)16(11)26)14-21(31)17(27)12(18(28)22(14)32)8-10-24(4,5)6/h1-6H3 |
| InChIKey | KQSLMGKEUUPWQL-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|