C19H30O — CID 90345902
(1S,4S,9S)-4-[(3Z)-hepta-3,6-dien-3-yl]-1,5-dimethyl-6-methylidene-10-oxabicyclo[7.1.0]decane (PubChem CID 90345902) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is (1S,4S,9S)-4-[(3Z)-hepta-3,6-dien-3-yl]-1,5-dimethyl-6-methylidene-10-oxabicyclo[7.1.0]decane.
| Compound Name | (1S,4S,9S)-4-[(3Z)-hepta-3,6-dien-3-yl]-1,5-dimethyl-6-methylidene-10-oxabicyclo[7.1.0]decane |
|---|---|
| PubChem CID | 90345902 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (1S,4S,9S)-4-[(3Z)-hepta-3,6-dien-3-yl]-1,5-dimethyl-6-methylidene-10-oxabicyclo[7.1.0]decane |
| SMILES | C=CC/C=C(/CC)[C@H]1CC[C@]2(C)O[C@H]2CCC(=C)C1C |
| InChI | InChI=1S/C19H30O/c1-6-8-9-16(7-2)17-12-13-19(5)18(20-19)11-10-14(3)15(17)4/h6,9,15,17-18H,1,3,7-8,10-13H2,2,4-5H3/b16-9-/t15?,17-,18-,19-/m0/s1 |
| InChIKey | SWQFFMKVJQBOGR-JHSPXUSZSA-N |
| XLogP | 5.44 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|