About (2S)-1-cyclohexa-1,5-dien-3-yn-1-ylpropan-2-amine
(2S)-1-cyclohexa-1,5-dien-3-yn-1-ylpropan-2-amine (PubChem CID 90346635) has the molecular formula C9H11N
and a molecular weight of 133.19 g/mol. Its IUPAC name is (2S)-1-cyclohexa-1,5-dien-3-yn-1-ylpropan-2-amine.
Molecular Properties
| Compound Name | (2S)-1-cyclohexa-1,5-dien-3-yn-1-ylpropan-2-amine |
| PubChem CID | 90346635 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | (2S)-1-cyclohexa-1,5-dien-3-yn-1-ylpropan-2-amine |
| SMILES | C[C@H](N)Cc1cc#ccc1 |
| InChI | InChI=1S/C9H11N/c1-8(10)7-9-5-3-2-4-6-9/h3,5-6,8H,7,10H2,1H3/t8-/m0/s1 |
| InChIKey | XXOLGBKHJCXYIY-QMMMGPOBSA-N |
| XLogP | 1.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-1-cyclohexa-1,5-dien-3-yn-1-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-cyclohexa-1,5-dien-3-yn-1-ylpropan-2-amine?
The IUPAC name of (2S)-1-cyclohexa-1,5-dien-3-yn-1-ylpropan-2-amine (CID 90346635) is (2S)-1-cyclohexa-1,5-dien-3-yn-1-ylpropan-2-amine.
What is the SMILES notation for (2S)-1-cyclohexa-1,5-dien-3-yn-1-ylpropan-2-amine?
The canonical SMILES for (2S)-1-cyclohexa-1,5-dien-3-yn-1-ylpropan-2-amine is C[C@H](N)Cc1cc#ccc1.
What is the InChIKey of (2S)-1-cyclohexa-1,5-dien-3-yn-1-ylpropan-2-amine?
The InChIKey is XXOLGBKHJCXYIY-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H11N/c1-8(10)7-9-5-3-2-4-6-9/h3,5-6,8H,7,10H2,1H3/t8-/m0/s1.
What are the key properties of (2S)-1-cyclohexa-1,5-dien-3-yn-1-ylpropan-2-amine?
(2S)-1-cyclohexa-1,5-dien-3-yn-1-ylpropan-2-amine has a molecular weight of 133.19 g/mol, XLogP of 1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-cyclohexa-1,5-dien-3-yn-1-ylpropan-2-amine is sourced from PubChem (CID 90346635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).