About (4R)-5-butoxy-2-fluoropentane-1,3,4-triol
(4R)-5-butoxy-2-fluoropentane-1,3,4-triol (PubChem CID 90346826) has the molecular formula C9H19FO4
and a molecular weight of 210.24 g/mol. Its IUPAC name is (4R)-5-butoxy-2-fluoropentane-1,3,4-triol.
Molecular Properties
| Compound Name | (4R)-5-butoxy-2-fluoropentane-1,3,4-triol |
| PubChem CID | 90346826 |
| Molecular Formula | C9H19FO4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (4R)-5-butoxy-2-fluoropentane-1,3,4-triol |
| SMILES | CCCCOC[C@@H](O)C(O)C(F)CO |
| InChI | InChI=1S/C9H19FO4/c1-2-3-4-14-6-8(12)9(13)7(10)5-11/h7-9,11-13H,2-6H2,1H3/t7?,8-,9?/m1/s1 |
| InChIKey | VUHOPXSXHOZDQS-QJAFJHJLSA-N |
| XLogP | -0.14 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4R)-5-butoxy-2-fluoropentane-1,3,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-5-butoxy-2-fluoropentane-1,3,4-triol?
The IUPAC name of (4R)-5-butoxy-2-fluoropentane-1,3,4-triol (CID 90346826) is (4R)-5-butoxy-2-fluoropentane-1,3,4-triol.
What is the SMILES notation for (4R)-5-butoxy-2-fluoropentane-1,3,4-triol?
The canonical SMILES for (4R)-5-butoxy-2-fluoropentane-1,3,4-triol is CCCCOC[C@@H](O)C(O)C(F)CO.
What is the InChIKey of (4R)-5-butoxy-2-fluoropentane-1,3,4-triol?
The InChIKey is VUHOPXSXHOZDQS-QJAFJHJLSA-N. The full InChI is InChI=1S/C9H19FO4/c1-2-3-4-14-6-8(12)9(13)7(10)5-11/h7-9,11-13H,2-6H2,1H3/t7?,8-,9?/m1/s1.
What are the key properties of (4R)-5-butoxy-2-fluoropentane-1,3,4-triol?
(4R)-5-butoxy-2-fluoropentane-1,3,4-triol has a molecular weight of 210.24 g/mol, XLogP of -0.14, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-5-butoxy-2-fluoropentane-1,3,4-triol is sourced from PubChem (CID 90346826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).