C20H42N2 — CID 90346860
1-N,4-N-bis(5-methylhexan-2-yl)cyclohexane-1,4-diamine (PubChem CID 90346860) has the molecular formula C20H42N2 and a molecular weight of 310.57 g/mol. Its IUPAC name is 1-N,4-N-bis(5-methylhexan-2-yl)cyclohexane-1,4-diamine.
| Compound Name | 1-N,4-N-bis(5-methylhexan-2-yl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 90346860 |
| Molecular Formula | C20H42N2 |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.33 |
| IUPAC Name | 1-N,4-N-bis(5-methylhexan-2-yl)cyclohexane-1,4-diamine |
| SMILES | CC(C)CCC(C)NC1CCC(NC(C)CCC(C)C)CC1 |
| InChI | InChI=1S/C20H42N2/c1-15(2)7-9-17(5)21-19-11-13-20(14-12-19)22-18(6)10-8-16(3)4/h15-22H,7-14H2,1-6H3 |
| InChIKey | QJIQFPZHWCOGPO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |