About 6-propan-2-ylimidazo[1,2-a]pyrazine-2-carbonitrile
6-propan-2-ylimidazo[1,2-a]pyrazine-2-carbonitrile (PubChem CID 90346979) has the molecular formula C10H10N4
and a molecular weight of 186.22 g/mol. Its IUPAC name is 6-propan-2-ylimidazo[1,2-a]pyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 6-propan-2-ylimidazo[1,2-a]pyrazine-2-carbonitrile |
| PubChem CID | 90346979 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 6-propan-2-ylimidazo[1,2-a]pyrazine-2-carbonitrile |
| SMILES | CC(C)c1cn2cc(C#N)nc2cn1 |
| InChI | InChI=1S/C10H10N4/c1-7(2)9-6-14-5-8(3-11)13-10(14)4-12-9/h4-7H,1-2H3 |
| InChIKey | NIWGZZBOJUZAAA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-propan-2-ylimidazo[1,2-a]pyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-ylimidazo[1,2-a]pyrazine-2-carbonitrile?
The IUPAC name of 6-propan-2-ylimidazo[1,2-a]pyrazine-2-carbonitrile (CID 90346979) is 6-propan-2-ylimidazo[1,2-a]pyrazine-2-carbonitrile.
What is the SMILES notation for 6-propan-2-ylimidazo[1,2-a]pyrazine-2-carbonitrile?
The canonical SMILES for 6-propan-2-ylimidazo[1,2-a]pyrazine-2-carbonitrile is CC(C)c1cn2cc(C#N)nc2cn1.
What is the InChIKey of 6-propan-2-ylimidazo[1,2-a]pyrazine-2-carbonitrile?
The InChIKey is NIWGZZBOJUZAAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4/c1-7(2)9-6-14-5-8(3-11)13-10(14)4-12-9/h4-7H,1-2H3.
What are the key properties of 6-propan-2-ylimidazo[1,2-a]pyrazine-2-carbonitrile?
6-propan-2-ylimidazo[1,2-a]pyrazine-2-carbonitrile has a molecular weight of 186.22 g/mol, XLogP of 1.72, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-ylimidazo[1,2-a]pyrazine-2-carbonitrile is sourced from PubChem (CID 90346979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).