C45H82N10O8 — CID 90347051
6-[2-[3-[2-[4,6-bis[bis(butoxymethyl)amino]-1,3,5-triazin-2-yl]ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]ethyl]-2-N,2-N,4-N,4-N-tetraethyl-1,3,5-triazine-2,4-diamine (PubChem CID 90347051) has the molecular formula C45H82N10O8 and a molecular weight of 891.21 g/mol. Its IUPAC name is 6-[2-[3-[2-[4,6-bis[bis(butoxymethyl)amino]-1,3,5-triazin-2-yl]ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]ethyl]-2-N,2-N,4-N,4-N-tetraethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[2-[3-[2-[4,6-bis[bis(butoxymethyl)amino]-1,3,5-triazin-2-yl]ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]ethyl]-2-N,2-N,4-N,4-N-tetraethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 90347051 |
| Molecular Formula | C45H82N10O8 |
| Molecular Weight | 891.21 g/mol |
| Exact Mass | 890.63 |
| IUPAC Name | 6-[2-[3-[2-[4,6-bis[bis(butoxymethyl)amino]-1,3,5-triazin-2-yl]ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]ethyl]-2-N,2-N,4-N,4-N-tetraethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCOCN(COCCCC)c1nc(CCC2OCC3(COC(CCc4nc(N(CC)CC)nc(N(CC)CC)n4)OC3)CO2)nc(N(COCCCC)COCCCC)n1 |
| InChI | InChI=1S/C45H82N10O8/c1-9-17-25-56-33-54(34-57-26-18-10-2)43-48-38(49-44(51-43)55(35-58-27-19-11-3)36-59-28-20-12-4)22-24-40-62-31-45(32-63-40)29-60-39(61-30-45)23-21-37-46-41(52(13-5)14-6)50-42(47-37)53(15-7)16-8/h39-40H,9-36H2,1-8H3 |
| InChIKey | TXBIMHOSYFEJNW-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 164.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.21 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|