C14H26F3NO — CID 90347347
3,3,3-trifluoro-N-(2,2,6,6-tetramethylheptan-3-yl)propanamide (PubChem CID 90347347) has the molecular formula C14H26F3NO and a molecular weight of 281.36 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-(2,2,6,6-tetramethylheptan-3-yl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-(2,2,6,6-tetramethylheptan-3-yl)propanamide |
|---|---|
| PubChem CID | 90347347 |
| Molecular Formula | C14H26F3NO |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 3,3,3-trifluoro-N-(2,2,6,6-tetramethylheptan-3-yl)propanamide |
| SMILES | CC(C)(C)CCC(NC(=O)CC(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C14H26F3NO/c1-12(2,3)8-7-10(13(4,5)6)18-11(19)9-14(15,16)17/h10H,7-9H2,1-6H3,(H,18,19) |
| InChIKey | ADFUEDRMHRUGCN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |