C14H29NO3S — CID 90347351
2-methylsulfonyl-N-(2,2,6,6-tetramethylheptan-3-yl)acetamide (PubChem CID 90347351) has the molecular formula C14H29NO3S and a molecular weight of 291.46 g/mol. Its IUPAC name is 2-methylsulfonyl-N-(2,2,6,6-tetramethylheptan-3-yl)acetamide.
| Compound Name | 2-methylsulfonyl-N-(2,2,6,6-tetramethylheptan-3-yl)acetamide |
|---|---|
| PubChem CID | 90347351 |
| Molecular Formula | C14H29NO3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 2-methylsulfonyl-N-(2,2,6,6-tetramethylheptan-3-yl)acetamide |
| SMILES | CC(C)(C)CCC(NC(=O)CS(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C14H29NO3S/c1-13(2,3)9-8-11(14(4,5)6)15-12(16)10-19(7,17)18/h11H,8-10H2,1-7H3,(H,15,16) |
| InChIKey | PJAFRRFXQHJQLJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |