C30H42O6 — CID 90347590
(24S,25R)-24,25-dibutoxy-2,19,22-trioxatetracyclo[19.3.1.04,9.012,17]pentacosa-4,6,8,12,14,16-hexaen-23-ol (PubChem CID 90347590) has the molecular formula C30H42O6 and a molecular weight of 498.66 g/mol. Its IUPAC name is (24S,25R)-24,25-dibutoxy-2,19,22-trioxatetracyclo[19.3.1.04,9.012,17]pentacosa-4,6,8,12,14,16-hexaen-23-ol.
| Compound Name | (24S,25R)-24,25-dibutoxy-2,19,22-trioxatetracyclo[19.3.1.04,9.012,17]pentacosa-4,6,8,12,14,16-hexaen-23-ol |
|---|---|
| PubChem CID | 90347590 |
| Molecular Formula | C30H42O6 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | (24S,25R)-24,25-dibutoxy-2,19,22-trioxatetracyclo[19.3.1.04,9.012,17]pentacosa-4,6,8,12,14,16-hexaen-23-ol |
| SMILES | CCCCO[C@@H]1C(O)OC2COCc3ccccc3CCc3ccccc3COC1[C@@H]2OCCCC |
| InChI | InChI=1S/C30H42O6/c1-3-5-17-33-27-26-21-32-19-24-13-9-7-11-22(24)15-16-23-12-8-10-14-25(23)20-35-28(27)29(30(31)36-26)34-18-6-4-2/h7-14,26-31H,3-6,15-21H2,1-2H3/t26?,27-,28?,29+,30?/m1/s1 |
| InChIKey | ITECRLAZUAMUPW-KVFOJSMWSA-N |
| XLogP | 4.97 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|