About N-[1-[3-(3,5-difluorophenyl)quinoxalin-2-yl]ethyl]-1H-imidazo[4,5-c]pyridin-4-amine
N-[1-[3-(3,5-difluorophenyl)quinoxalin-2-yl]ethyl]-1H-imidazo[4,5-c]pyridin-4-amine (PubChem CID 90347930) has the molecular formula C22H16F2N6
and a molecular weight of 402.41 g/mol. Its IUPAC name is N-[1-[3-(3,5-difluorophenyl)quinoxalin-2-yl]ethyl]-1H-imidazo[4,5-c]pyridin-4-amine.
Molecular Properties
| Compound Name | N-[1-[3-(3,5-difluorophenyl)quinoxalin-2-yl]ethyl]-1H-imidazo[4,5-c]pyridin-4-amine |
| PubChem CID | 90347930 |
| Molecular Formula | C22H16F2N6 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-[1-[3-(3,5-difluorophenyl)quinoxalin-2-yl]ethyl]-1H-imidazo[4,5-c]pyridin-4-amine |
| SMILES | CC(Nc1nccc2[nH]cnc12)c1nc2ccccc2nc1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C22H16F2N6/c1-12(28-22-21-18(6-7-25-22)26-11-27-21)19-20(13-8-14(23)10-15(24)9-13)30-17-5-3-2-4-16(17)29-19/h2-12H,1H3,(H,25,28)(H,26,27) |
| InChIKey | UICBXWCMPYZGAD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-[3-(3,5-difluorophenyl)quinoxalin-2-yl]ethyl]-1H-imidazo[4,5-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[3-(3,5-difluorophenyl)quinoxalin-2-yl]ethyl]-1H-imidazo[4,5-c]pyridin-4-amine?
The IUPAC name of N-[1-[3-(3,5-difluorophenyl)quinoxalin-2-yl]ethyl]-1H-imidazo[4,5-c]pyridin-4-amine (CID 90347930) is N-[1-[3-(3,5-difluorophenyl)quinoxalin-2-yl]ethyl]-1H-imidazo[4,5-c]pyridin-4-amine.
What is the SMILES notation for N-[1-[3-(3,5-difluorophenyl)quinoxalin-2-yl]ethyl]-1H-imidazo[4,5-c]pyridin-4-amine?
The canonical SMILES for N-[1-[3-(3,5-difluorophenyl)quinoxalin-2-yl]ethyl]-1H-imidazo[4,5-c]pyridin-4-amine is CC(Nc1nccc2[nH]cnc12)c1nc2ccccc2nc1-c1cc(F)cc(F)c1.
What is the InChIKey of N-[1-[3-(3,5-difluorophenyl)quinoxalin-2-yl]ethyl]-1H-imidazo[4,5-c]pyridin-4-amine?
The InChIKey is UICBXWCMPYZGAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16F2N6/c1-12(28-22-21-18(6-7-25-22)26-11-27-21)19-20(13-8-14(23)10-15(24)9-13)30-17-5-3-2-4-16(17)29-19/h2-12H,1H3,(H,25,28)(H,26,27).
What are the key properties of N-[1-[3-(3,5-difluorophenyl)quinoxalin-2-yl]ethyl]-1H-imidazo[4,5-c]pyridin-4-amine?
N-[1-[3-(3,5-difluorophenyl)quinoxalin-2-yl]ethyl]-1H-imidazo[4,5-c]pyridin-4-amine has a molecular weight of 402.41 g/mol, XLogP of 5.02, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[3-(3,5-difluorophenyl)quinoxalin-2-yl]ethyl]-1H-imidazo[4,5-c]pyridin-4-amine is sourced from PubChem (CID 90347930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).