C21H20O6 — CID 90347964
[(1R,3R,4R,5R)-3-[(1R)-1-benzoyloxyethyl]-5-methyl-2,6-dioxabicyclo[3.1.0]hexan-4-yl] benzoate (PubChem CID 90347964) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is [(1R,3R,4R,5R)-3-[(1R)-1-benzoyloxyethyl]-5-methyl-2,6-dioxabicyclo[3.1.0]hexan-4-yl] benzoate.
| Compound Name | [(1R,3R,4R,5R)-3-[(1R)-1-benzoyloxyethyl]-5-methyl-2,6-dioxabicyclo[3.1.0]hexan-4-yl] benzoate |
|---|---|
| PubChem CID | 90347964 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | [(1R,3R,4R,5R)-3-[(1R)-1-benzoyloxyethyl]-5-methyl-2,6-dioxabicyclo[3.1.0]hexan-4-yl] benzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1)[C@H]1O[C@@H]2O[C@]2(C)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20O6/c1-13(24-18(22)14-9-5-3-6-10-14)16-17(21(2)20(25-16)27-21)26-19(23)15-11-7-4-8-12-15/h3-13,16-17,20H,1-2H3/t13-,16-,17-,20-,21-/m1/s1 |
| InChIKey | GLFLRBKSXNCOCF-GNPZUCITSA-N |
| XLogP | 2.97 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|