C19H26N5O7P — CID 90348019
[(1R)-1-[(3aR,4R,6S,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]ethyl] 2-cyanoethyl hydrogen phosphate (PubChem CID 90348019) has the molecular formula C19H26N5O7P and a molecular weight of 467.42 g/mol. Its IUPAC name is [(1R)-1-[(3aR,4R,6S,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]ethyl] 2-cyanoethyl hydrogen phosphate.
| Compound Name | [(1R)-1-[(3aR,4R,6S,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]ethyl] 2-cyanoethyl hydrogen phosphate |
|---|---|
| PubChem CID | 90348019 |
| Molecular Formula | C19H26N5O7P |
| Molecular Weight | 467.42 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | [(1R)-1-[(3aR,4R,6S,6aR)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]ethyl] 2-cyanoethyl hydrogen phosphate |
| SMILES | C[C@@H](OP(=O)(O)OCCC#N)[C@H]1O[C@@H](n2ccc3c(N)ncnc32)[C@]2(C)OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C19H26N5O7P/c1-11(30-32(25,26)27-9-5-7-20)13-14-19(4,31-18(2,3)29-14)17(28-13)24-8-6-12-15(21)22-10-23-16(12)24/h6,8,10-11,13-14,17H,5,9H2,1-4H3,(H,25,26)(H2,21,22,23)/t11-,13-,14-,17-,19-/m1/s1 |
| InChIKey | YJWRJVKGTQBYTF-XTKAHFKISA-N |
| XLogP | 2.26 |
| TPSA | 163.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|