C15H21N3O4 — CID 90348064
(2R,3R,4R,5S)-2-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-5-(2-hydroxypropan-2-yl)-3-methyloxolane-3,4-diol (PubChem CID 90348064) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-5-(2-hydroxypropan-2-yl)-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-5-(2-hydroxypropan-2-yl)-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 90348064 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | (2R,3R,4R,5S)-2-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-5-(2-hydroxypropan-2-yl)-3-methyloxolane-3,4-diol |
| SMILES | CC(C)(O)[C@H]1O[C@@H](n2ccc3c(N)ccnc32)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C15H21N3O4/c1-14(2,20)11-10(19)15(3,21)13(22-11)18-7-5-8-9(16)4-6-17-12(8)18/h4-7,10-11,13,19-21H,1-3H3,(H2,16,17)/t10-,11+,13-,15-/m1/s1 |
| InChIKey | GJKYFACCACNELW-NDPMZMCLSA-N |
| XLogP | 0.40 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |