C19H23N3O5S — CID 9034878
2-methoxy-N-[(2S)-3-methyl-1-oxo-1-(4-sulfamoylanilino)butan-2-yl]benzamide (PubChem CID 9034878) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-methoxy-N-[(2S)-3-methyl-1-oxo-1-(4-sulfamoylanilino)butan-2-yl]benzamide.
| Compound Name | 2-methoxy-N-[(2S)-3-methyl-1-oxo-1-(4-sulfamoylanilino)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 9034878 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 2-methoxy-N-[(2S)-3-methyl-1-oxo-1-(4-sulfamoylanilino)butan-2-yl]benzamide |
| SMILES | COc1ccccc1C(=O)N[C@H](C(=O)Nc1ccc(S(N)(=O)=O)cc1)C(C)C |
| InChI | InChI=1S/C19H23N3O5S/c1-12(2)17(22-18(23)15-6-4-5-7-16(15)27-3)19(24)21-13-8-10-14(11-9-13)28(20,25)26/h4-12,17H,1-3H3,(H,21,24)(H,22,23)(H2,20,25,26)/t17-/m0/s1 |
| InChIKey | SIULEVAGJABYOC-KRWDZBQOSA-N |
| XLogP | 1.74 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |