About 2-cyclohexylpropan-2-yl 3-(4-propan-2-ylphenoxy)adamantane-1-carboxylate
2-cyclohexylpropan-2-yl 3-(4-propan-2-ylphenoxy)adamantane-1-carboxylate (PubChem CID 90349117) has the molecular formula C29H42O3
and a molecular weight of 438.65 g/mol. Its IUPAC name is 2-cyclohexylpropan-2-yl 3-(4-propan-2-ylphenoxy)adamantane-1-carboxylate.
Molecular Properties
| Compound Name | 2-cyclohexylpropan-2-yl 3-(4-propan-2-ylphenoxy)adamantane-1-carboxylate |
| PubChem CID | 90349117 |
| Molecular Formula | C29H42O3 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | 2-cyclohexylpropan-2-yl 3-(4-propan-2-ylphenoxy)adamantane-1-carboxylate |
| SMILES | CC(C)c1ccc(OC23CC4CC(C2)CC(C(=O)OC(C)(C)C2CCCCC2)(C4)C3)cc1 |
| InChI | InChI=1S/C29H42O3/c1-20(2)23-10-12-25(13-11-23)31-29-17-21-14-22(18-29)16-28(15-21,19-29)26(30)32-27(3,4)24-8-6-5-7-9-24/h10-13,20-22,24H,5-9,14-19H2,1-4H3 |
| InChIKey | CQXVGZTXTSFMJQ-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclohexylpropan-2-yl 3-(4-propan-2-ylphenoxy)adamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylpropan-2-yl 3-(4-propan-2-ylphenoxy)adamantane-1-carboxylate?
The IUPAC name of 2-cyclohexylpropan-2-yl 3-(4-propan-2-ylphenoxy)adamantane-1-carboxylate (CID 90349117) is 2-cyclohexylpropan-2-yl 3-(4-propan-2-ylphenoxy)adamantane-1-carboxylate.
What is the SMILES notation for 2-cyclohexylpropan-2-yl 3-(4-propan-2-ylphenoxy)adamantane-1-carboxylate?
The canonical SMILES for 2-cyclohexylpropan-2-yl 3-(4-propan-2-ylphenoxy)adamantane-1-carboxylate is CC(C)c1ccc(OC23CC4CC(C2)CC(C(=O)OC(C)(C)C2CCCCC2)(C4)C3)cc1.
What is the InChIKey of 2-cyclohexylpropan-2-yl 3-(4-propan-2-ylphenoxy)adamantane-1-carboxylate?
The InChIKey is CQXVGZTXTSFMJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H42O3/c1-20(2)23-10-12-25(13-11-23)31-29-17-21-14-22(18-29)16-28(15-21,19-29)26(30)32-27(3,4)24-8-6-5-7-9-24/h10-13,20-22,24H,5-9,14-19H2,1-4H3.
What are the key properties of 2-cyclohexylpropan-2-yl 3-(4-propan-2-ylphenoxy)adamantane-1-carboxylate?
2-cyclohexylpropan-2-yl 3-(4-propan-2-ylphenoxy)adamantane-1-carboxylate has a molecular weight of 438.65 g/mol, XLogP of 7.43, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylpropan-2-yl 3-(4-propan-2-ylphenoxy)adamantane-1-carboxylate is sourced from PubChem (CID 90349117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).