C18H15F3N6O — CID 90349257
(Z)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-pyridin-2-ylprop-2-enehydrazide (PubChem CID 90349257) has the molecular formula C18H15F3N6O and a molecular weight of 388.35 g/mol. Its IUPAC name is (Z)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-pyridin-2-ylprop-2-enehydrazide.
| Compound Name | (Z)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-pyridin-2-ylprop-2-enehydrazide |
|---|---|
| PubChem CID | 90349257 |
| Molecular Formula | C18H15F3N6O |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | (Z)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-pyridin-2-ylprop-2-enehydrazide |
| SMILES | Cc1cc(-c2ncn(/C=C\C(=O)NNc3ccccn3)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F3N6O/c1-12-8-13(10-14(9-12)18(19,20)21)17-23-11-27(26-17)7-5-16(28)25-24-15-4-2-3-6-22-15/h2-11H,1H3,(H,22,24)(H,25,28)/b7-5- |
| InChIKey | GRFBKCHJJWQMTM-ALCCZGGFSA-N |
| XLogP | 3.28 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|