C21H16F3N7O — CID 90349265
(Z)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-quinoxalin-2-ylprop-2-enehydrazide (PubChem CID 90349265) has the molecular formula C21H16F3N7O and a molecular weight of 439.40 g/mol. Its IUPAC name is (Z)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-quinoxalin-2-ylprop-2-enehydrazide.
| Compound Name | (Z)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-quinoxalin-2-ylprop-2-enehydrazide |
|---|---|
| PubChem CID | 90349265 |
| Molecular Formula | C21H16F3N7O |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | (Z)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-N'-quinoxalin-2-ylprop-2-enehydrazide |
| SMILES | Cc1cc(-c2ncn(/C=C\C(=O)NNc3cnc4ccccc4n3)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H16F3N7O/c1-13-8-14(10-15(9-13)21(22,23)24)20-26-12-31(30-20)7-6-19(32)29-28-18-11-25-16-4-2-3-5-17(16)27-18/h2-12H,1H3,(H,27,28)(H,29,32)/b7-6- |
| InChIKey | RDCYELYBZPMSIU-SREVYHEPSA-N |
| XLogP | 3.83 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|